Compound 213
Identifiers
- Canonical SMILES:
CC(C)(C)S(=O)(=O)c1cc(ccc1N[C@H](CCN1CCOCC1)CSc1ccccc1)S(=O)(=O)Nc1ncnc2CN(CCc12)C1CCN(CC2=C(CC(C)(C)CC2)c2ccc(Cl)cc2)CC1
- InChi:
InChI=1S/C51H68ClN7O5S3/c1-50(2,3)66(60,61)48-31-43(15-16-46(48)55-40(18-23-57-27-29-64-30-28-57)35-65-42-9-7-6-8-10-42)67(62,63)56-49-44-21-26-59(34-47(44)53-36-54-49)41-19-24-58(25-20-41)33-38-17-22-51(4,5)32-45(38)37-11-13-39(52)14-12-37/h6-16,31,36,40-41,55H,17-30,32-35H2,1-5H3,(H,53,54,56)/t40-/m1/s1
- InChiKey:
DJSNNNJGIIDYTC-RRHRGVEJSA-N
External links
![]() 168318249 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Karen Miller-Moslin, Bakary-Barry Toure, Michael Scott Visser, Naeem Yusuff, Novartis Ag. . Sulfonamides as inhibitors of bcl-2 family proteins for the treatment of cancer None. | 16 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
BCL2-Like / BAX | 7.39 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 989.41 g/mol | |||
HBA | 12 | |||
HBD | 2 | |||
HBA + HBD | 14 | |||
AlogP | 6.34 | |||
TPSA | 137.07 | |||
RB | 16 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2011029842 | 16 | BCL2 P10415 |
|
Biochemical assay | Surface Plasmon Resonance | pIC50 (half maximal inhibitory concentration, -log10) | 7.39 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.6246 | Navitoclax | DB12340 | |
0.4198 | Venetoclax | DB11581 | |
0.3882 | GDC-0349 | DB13072 | |
0.3844 | Quinupristin | DB01369 | |
0.3810 | Henatinib | DB13019 | |
0.3733 | Presatovir | DB12165 | |
0.3717 | (3Z)-N,N-DIMETHYL-2-OXO-3-(4,5,6,7-TETRAHYDRO-1H-INDOL-2-YLMETHYLIDENE)-2,3-DIHYDRO-1H-INDOLE-5-SULFONAMIDE | DB08039 | |
0.3645 | Vintafolide | DB05168 | |
0.3619 | Vinpocetine | DB12131 | |
0.3601 | Lurbinectedin | DB12674 | |
0.3596 | (4aS)-5-[(2,4-diaminopteridin-6-yl)methyl]-4a,5-dihydro-2H-dibenzo[b,f]azepin-8-ol | DB08448 | |
0.3593 | Bleomycin | DB00290 | |
0.3560 | TMC-647055 | DB11822 | |
0.3557 | Satavaptan | DB14923 | |
0.3529 | Sparsentan | DB12548 |