Compound 200
Identifiers
- Canonical SMILES:
FC(F)(F)c1ccc(O[C@@]2(CCCN(C2)C(=O)C2(CC2)c2ccc(Cl)cc2)C(=O)NCCc2ccccc2)cc1
- IUPAC name:
1-[1-(4-chlorophenyl)cyclopropanecarbonyl]-N-(2-phenylethyl)-3-[4-(trifluoromethyl)phenoxy]piperidine-3-carboxamide
- InChi:
InChI=1S/C31H30ClF3N2O3/c32-25-11-7-23(8-12-25)29(17-18-29)28(39)37-20-4-16-30(21-37,27(38)36-19-15-22-5-2-1-3-6-22)40-26-13-9-24(10-14-26)31(33,34)35/h1-3,5-14H,4,15-21H2,(H,36,38)/t30-/m1/s1
- InChiKey:
YPAQBCLUJBPATB-SSEXGKCCSA-N
External links
168318314 |
External search
Bibliography (1)
Publication | Name |
---|---|
Yaolin Wang, Rumin Zhang, Yao Ma, Brian R. Lahue, Gerald W. Shipps, Jr., Schering Corporation. . Method of using substituted piperidines that increase p53 activity None. | 2 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 5.85 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 570.19 g/mol | |||
HBA | 5 | |||
HBD | 1 | |||
HBA + HBD | 6 | |||
AlogP | 6.61 | |||
TPSA | 58.64 | |||
RB | 9 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2008005266 | 2 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 5.85 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.5634 | (9S,12S)-9-(1-methylethyl)-7,10-dioxo-2-oxa-8,11-diazabicyclo[12.2.2]octadeca-1(16),14,17-triene-12-carboxylic acid | DB07679 | |
0.5460 | Lopinavir | DB01601 | |
0.5368 | PF-03635659 | DB12408 | |
0.5278 | SR 140333 | DB05790 | |
0.5233 | Taranabant | DB06624 | |
0.5203 | Aliskiren | DB09026 | |
0.5181 | GW-559090 | DB06508 | |
0.5135 | Fradafiban | DB06472 | |
0.5070 | KH064 | DB04287 | |
0.5000 | R-30490 | DB09179 | |
0.5000 | HT-0712 | DB11650 | |
0.5000 | Embutramide | DB01487 | |
0.4972 | Rimiducid | DB04974 | |
0.4972 | {3-[3-(3,4-Dimethoxy-Phenyl)-1-(1-{1-[2-(3,4,5-Trimethoxy-Phenyl)-Butyryl]-Piperidin-2yl}-Vinyloxy)-Propyl]-Phenoxy}-Acetic Acid | DB01723 | |
0.4938 | 3-Amino-N-{4-[2-(2,6-Dimethyl-Phenoxy)-Acetylamino]-3-Hydroxy-1-Isobutyl-5-Phenyl-Pentyl}-Benzamide | DB04378 |