Compound 1929
Identifiers
- Canonical SMILES:
c1c(c(c(cc1c1c(c(c(c(c1)Cl)Cl)Cl)O)Cl)Cl)Cl
- InChi:
InChI=1S/C12H4Cl6O/c13-6-1-4(2-7(14)9(6)16)5-3-8(15)10(17)11(18)12(5)19/h1-3,19H
- InChiKey:
SASAWKFCSDRAGD-UHFFFAOYSA-N
External links
![]() 6454632 |
![]() CHEMBL160172 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Rickenbacher U, McKinney JD, Oatley SJ, Blake CC. . Structurally specific binding of halogenated biphenyls to thyroxine transport protein. Journal of medicinal chemistry. | 18 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
0 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | not available | |||
HBA | not available | |||
HBD | not available | |||
HBA + HBD | not available | |||
AlogP | not available | |||
TPSA | not available | |||
RB | not available |
Radar chart
Compound properties unavailable
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 0 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.7451 | 3,3',5,5'-tetrachlorobiphenyl-4,4'-diol | DB03346 | |
0.6346 | 1-CHLORO-6-(4-HYDROXYPHENYL)-2-NAPHTHOL | DB07119 | |
0.6167 | 2',6'-Dichloro-Biphenyl-2,6-Diol | DB03259 | |
0.5833 | 2'-Chloro-Biphenyl-2,3-Diol | DB01925 | |
0.5472 | 2-chloro-4,5-dimethylphenol | DB15658 | |
0.5185 | Biphenyl-2,3-Diol | DB02923 | |
0.5000 | Hexachlorophene | DB00756 | |
0.4906 | Chloroxylenol | DB11121 | |
0.4675 | 2',4'-DICHLORO-4-HYDROXY-1,1'-BIPHENYL-3-CARBOXYLIC ACID | DB07047 | |
0.4603 | Dichlorophen | DB11396 | |
0.4342 | 2'-HYDROXY-1,1'-BIPHENYL-2-SULFINIC ACID | DB08319 | |
0.4286 | 3,4-Biphenyldiol | DB07478 | |
0.4286 | 3-Chlorophenol | DB01957 | |
0.4082 | 2-Chlorophenol | DB03110 | |
0.4082 | Parachlorophenol | DB13154 |