Compound 1919
Identifiers
- Canonical SMILES:
c1(cccc(c1c1c(cccc1Cl)Cl)Cl)Cl
- InChi:
InChI=1S/C12H6Cl4/c13-7-3-1-4-8(14)11(7)12-9(15)5-2-6-10(12)16/h1-6H
- InChiKey:
PXAGFNRKXSYIHU-UHFFFAOYSA-N
External links
![]() 27588 |
![]() CHEMBL82258 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Rickenbacher U, McKinney JD, Oatley SJ, Blake CC. . Structurally specific binding of halogenated biphenyls to thyroxine transport protein. Journal of medicinal chemistry. | 8 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
0 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | not available | |||
HBA | not available | |||
HBD | not available | |||
HBA + HBD | not available | |||
AlogP | not available | |||
TPSA | not available | |||
RB | not available |
Radar chart
Compound properties unavailable
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 0 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.6326 | 2',6'-Dichloro-Biphenyl-2,6-Diol | DB03259 | |
0.6000 | 3,3',5,5'-tetrachlorobiphenyl-4,4'-diol | DB03346 | |
0.5918 | 2'-Chloro-Biphenyl-2,3-Diol | DB01925 | |
0.5814 | 1-CHLORO-6-(4-HYDROXYPHENYL)-2-NAPHTHOL | DB07119 | |
0.5366 | Dichlorobenzyl alcohol | DB13269 | |
0.5294 | p-Quaterphenyl | DB12794 | |
0.4769 | 2',4'-DICHLORO-4-HYDROXY-1,1'-BIPHENYL-3-CARBOXYLIC ACID | DB07047 | |
0.4762 | 4,4'-BIS([H]METHYLSULFONYL)-2,2',5,5'-TETRACHLOROBIPHENYL | DB08373 | |
0.4762 | Chloroxylenol | DB11121 | |
0.4688 | 1,3,5-trichlorobenzene | DB03836 | |
0.4130 | 2-chloro-4,5-dimethylphenol | DB15658 | |
0.4091 | 1-biphenyl-2-ylmethanamine | DB07412 | |
0.4000 | 3,4-Biphenyldiol | DB07478 | |
0.4000 | Guanabenz | DB00629 | |
0.4000 | Clortermine | DB01527 |