Compound 1915
Identifiers
- Canonical SMILES:
N[C@@H](Cc1cc(c(Oc2cc(c(O)c(c2)I)I)cc1)I)C(=O)O
- InChi:
InChI=1S/C15H12I3NO4/c16-9-3-7(4-12(19)15(21)22)1-2-13(9)23-8-5-10(17)14(20)11(18)6-8/h1-3,5-6,12,20H,4,19H2,(H,21,22)/t12-/m0/s1
- InChiKey:
HZCBWYNLGPIQRK-LBPRGKRZSA-N
External links
644280 |
CHEMBL1743304 |
T44 |
External search
Bibliography (1)
Publication | Name |
---|---|
Rickenbacher U, McKinney JD, Oatley SJ, Blake CC. . Structurally specific binding of halogenated biphenyls to thyroxine transport protein. Journal of medicinal chemistry. | L-rT3 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
TTR | 7.36 | Stabilization |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | not available | |||
HBA | not available | |||
HBD | not available | |||
HBA + HBD | not available | |||
AlogP | not available | |||
TPSA | not available | |||
RB | not available |
Radar chart
Compound properties unavailable
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
1.0000 | Liothyronine I-131 | DB12425 | |
1.0000 | Liothyronine | DB00279 | |
1.0000 | Levothyroxine | DB00451 | |
1.0000 | Dextrothyroxine | DB00509 | |
0.8395 | 3,5-diiodothyropropionic acid | DB12629 | |
0.7654 | 3,5-Diiodotyrosine | DB03374 | |
0.7407 | 3-Iodo-Tyrosine | DB01758 | |
0.6966 | Tiratricol | DB03604 | |
0.6966 | Tetraiodothyroacetic acid | DB01751 | |
0.6322 | D-fluoromethyltyrosine F-18 | DB15296 | |
0.6322 | FET F-18 | DB15405 | |
0.5926 | D-Tyrosine | DB03839 | |
0.5926 | Tyrosine | DB00135 | |
0.5926 | Metyrosine | DB00765 | |
0.5882 | Methyldopa | DB00968 |