Compound 1914
Identifiers
- Canonical SMILES:
N[C@@H](Cc1cc(c(Oc2cc(c(O)cc2)I)c(c1)I)I)C(=O)O
- InChi:
InChI=1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1
- InChiKey:
AUYYCJSJGJYCDS-LBPRGKRZSA-N
External links
![]() 5920 |
![]() CHEMBL1544 |
T3 |
DB00279 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Rickenbacher U, McKinney JD, Oatley SJ, Blake CC. . Structurally specific binding of halogenated biphenyls to thyroxine transport protein. Journal of medicinal chemistry. | L-T3 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| TTR | 6.22 | Stabilization |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | not available | |||
| HBA | not available | |||
| HBD | not available | |||
| HBA + HBD | not available | |||
| AlogP | not available | |||
| TPSA | not available | |||
| RB | not available |
Radar chart
Compound properties unavailable
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 1.0000 | Liothyronine I-131 | DB12425 | |
| 1.0000 | Liothyronine | DB00279 | |
| 1.0000 | Levothyroxine | DB00451 | |
| 1.0000 | Dextrothyroxine | DB00509 | |
| 0.8395 | 3,5-diiodothyropropionic acid | DB12629 | |
| 0.7654 | 3,5-Diiodotyrosine | DB03374 | |
| 0.7407 | 3-Iodo-Tyrosine | DB01758 | |
| 0.6966 | Tiratricol | DB03604 | |
| 0.6966 | Tetraiodothyroacetic acid | DB01751 | |
| 0.6322 | D-fluoromethyltyrosine F-18 | DB15296 | |
| 0.6322 | FET F-18 | DB15405 | |
| 0.5926 | D-Tyrosine | DB03839 | |
| 0.5926 | Tyrosine | DB00135 | |
| 0.5926 | Metyrosine | DB00765 | |
| 0.5882 | Methyldopa | DB00968 |




