Compound 1913
Identifiers
- Common name: DL-thyroxine
- Canonical SMILES:
N[C@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)O
- InChi:
InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m1/s1
- InChiKey:
XUIIKFGFIJCVMT-GFCCVEGCSA-N
External links
![]() 8730 |
![]() CHEMBL559 |
T44 |
DB00509 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Rickenbacher U, McKinney JD, Oatley SJ, Blake CC. . Structurally specific binding of halogenated biphenyls to thyroxine transport protein. Journal of medicinal chemistry. | DL-T4 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
TTR | 7.80 | Stabilization |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | not available | |||
HBA | not available | |||
HBD | not available | |||
HBA + HBD | not available | |||
AlogP | not available | |||
TPSA | not available | |||
RB | not available |
Radar chart
Compound properties unavailable
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
1.0000 | Liothyronine I-131 | DB12425 | |
1.0000 | Liothyronine | DB00279 | |
1.0000 | Levothyroxine | DB00451 | |
1.0000 | Dextrothyroxine | DB00509 | |
0.8395 | 3,5-diiodothyropropionic acid | DB12629 | |
0.7654 | 3,5-Diiodotyrosine | DB03374 | |
0.7407 | 3-Iodo-Tyrosine | DB01758 | |
0.6966 | Tiratricol | DB03604 | |
0.6966 | Tetraiodothyroacetic acid | DB01751 | |
0.6322 | D-fluoromethyltyrosine F-18 | DB15296 | |
0.6322 | FET F-18 | DB15405 | |
0.5926 | D-Tyrosine | DB03839 | |
0.5926 | Tyrosine | DB00135 | |
0.5926 | Metyrosine | DB00765 | |
0.5882 | Methyldopa | DB00968 |