Compound 1712
Identifiers
- Canonical SMILES:
Brc1ccccc1-c1csc(=N/CC=C)n1N=Cc1ccccn1
- IUPAC name:
(NE,2E)-4-(2-bromophenyl)-2-(prop-2-en-1-ylimino)-N-(pyridin-2-ylmethylidene)-1,3-thiazol-3-amine
- InChi:
InChI=1S/C18H15BrN4S/c1-2-10-21-18-23(22-12-14-7-5-6-11-20-14)17(13-24-18)15-8-3-4-9-16(15)19/h2-9,11-13H,1,10H2
- InChiKey:
XGYNUNWQRPKZBS-UHFFFAOYSA-N
External links
![]() 2471634 |
![]() CHEMBL2311912 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 59 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LEDGF / IN | 4.64 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 398.02 g/mol | |||
| HBA | 4 | |||
| HBD | 0 | |||
| HBA + HBD | 4 | |||
| AlogP | 5.00 | |||
| TPSA | 40.85 | |||
| RB | 5 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.3348 | 4-{4-[(5-hydroxy-2-methylphenyl)amino]quinolin-7-yl}-1,3-thiazole-2-carbaldehyde | DB07832 | |
| 0.3307 | Tetomilast | DB05298 | |
| 0.3305 | 4-{[4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-yl]amino}-2-hydroxybenzoic acid | DB07616 | |
| 0.3206 | Masitinib | DB11526 | |
| 0.3206 | Faldaprevir | DB11808 | |
| 0.3075 | Vedroprevir | DB12037 | |
| 0.3047 | Ciluprevir | DB05868 | |
| 0.3012 | {4-[3-(6,7-Diethoxy-Quinazolin-4-Ylamino)-Phenyl]-Thiazol-2-Yl}-Methanol | DB02848 | |
| 0.2985 | Pritelivir | DB11844 | |
| 0.2980 | 4-(2-amino-1,3-thiazol-4-yl)phenol | DB07292 | |
| 0.2927 | Ziritaxestat | DB15403 | |
| 0.2904 | GDC-0917 | DB12336 | |
| 0.2822 | Lintitript | DB04867 | |
| 0.2799 | Amcasertib | DB14866 | |
| 0.2772 | GS-9256 | DB12876 |




