Compound 1711
Identifiers
- Canonical SMILES:
CCN=c1/scc(-c2cc(OC)ccc2OC)n1N=C(/C)c1ccco1
- IUPAC name:
(NE,2E)-4-(2,5-dimethoxyphenyl)-2-(ethylimino)-N-[1-(furan-2-yl)ethylidene]-1,3-thiazol-3-amine
- InChi:
InChI=1S/C19H21N3O3S/c1-5-20-19-22(21-13(2)17-7-6-10-25-17)16(12-26-19)15-11-14(23-3)8-9-18(15)24-4/h6-12H,5H2,1-4H3
- InChiKey:
YEOMQAMBEFCHPQ-UHFFFAOYSA-N
External links
![]() 5145260 |
![]() CHEMBL2311911 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 58 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LEDGF / IN | 5.10 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 371.13 g/mol | |||
| HBA | 6 | |||
| HBD | 0 | |||
| HBA + HBD | 6 | |||
| AlogP | 2.99 | |||
| TPSA | 59.56 | |||
| RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.3474 | Lusutrombopag | DB13125 | |
| 0.3463 | Abafungin | DB06395 | |
| 0.3360 | 4-{[4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-yl]amino}-2-hydroxybenzoic acid | DB07616 | |
| 0.3309 | Tetomilast | DB05298 | |
| 0.3174 | Faldaprevir | DB11808 | |
| 0.3123 | Vedroprevir | DB12037 | |
| 0.3118 | BMS-986141 | DB14942 | |
| 0.3080 | 4-{4-[(5-hydroxy-2-methylphenyl)amino]quinolin-7-yl}-1,3-thiazole-2-carbaldehyde | DB07832 | |
| 0.3066 | 4-(2-amino-1,3-thiazol-4-yl)phenol | DB07292 | |
| 0.3060 | Ciluprevir | DB05868 | |
| 0.2935 | {4-[3-(6,7-Diethoxy-Quinazolin-4-Ylamino)-Phenyl]-Thiazol-2-Yl}-Methanol | DB02848 | |
| 0.2889 | GS-9256 | DB12876 | |
| 0.2877 | PF-05089771 | DB14856 | |
| 0.2852 | Quinfamide | DB12780 | |
| 0.2842 | Acotiamide | DB12482 |




