Compound 1710
Identifiers
- Canonical SMILES:
COCCN=c1/scc(-c2cccs2)n1N=Cc1cc(Br)c(O)c(OC)c1
- IUPAC name:
2-bromo-6-methoxy-4-[(E)-N-[(2E)-2-[(2-methoxyethyl)imino]-4-(thiophen-2-yl)-1,3-thiazol-3-yl]carboximidoyl]phenol
- InChi:
InChI=1S/C18H18BrN3O3S2/c1-24-6-5-20-18-22(14(11-27-18)16-4-3-7-26-16)21-10-12-8-13(19)17(23)15(9-12)25-2/h3-4,7-11,23H,5-6H2,1-2H3
- InChiKey:
SKPUUEBMTHFTRP-UHFFFAOYSA-N
External links
![]() 2455881 |
![]() CHEMBL2311910 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 57 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LEDGF / IN | 4.85 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 467.00 g/mol | |||
| HBA | 6 | |||
| HBD | 1 | |||
| HBA + HBD | 7 | |||
| AlogP | 4.21 | |||
| TPSA | 66.65 | |||
| RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.3548 | Arotinolol | DB09204 | |
| 0.3440 | FR117016 | DB02616 | |
| 0.3370 | Tetomilast | DB05298 | |
| 0.3168 | 4-{[4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-yl]amino}-2-hydroxybenzoic acid | DB07616 | |
| 0.3141 | {4-[3-(6,7-Diethoxy-Quinazolin-4-Ylamino)-Phenyl]-Thiazol-2-Yl}-Methanol | DB02848 | |
| 0.3041 | Faldaprevir | DB11808 | |
| 0.2964 | Avatrombopag | DB11995 | |
| 0.2917 | Vedroprevir | DB12037 | |
| 0.2909 | 4-(2-amino-1,3-thiazol-4-yl)phenol | DB07292 | |
| 0.2896 | Sitravatinib | DB15036 | |
| 0.2873 | Simeprevir | DB06290 | |
| 0.2862 | Masitinib | DB11526 | |
| 0.2857 | Ciluprevir | DB05868 | |
| 0.2849 | Dabrafenib | DB08912 | |
| 0.2846 | 4-{4-[(5-hydroxy-2-methylphenyl)amino]quinolin-7-yl}-1,3-thiazole-2-carbaldehyde | DB07832 |




