Compound 171
Identifiers
- Canonical SMILES:
CO[C@@]1(Cc2ccccc2Br)CC[C@@H](CC1)N1CCc2c(C1)ncnc2NS(=O)(=O)c1ccc(N[C@H](CCN(C)C)CSc2ccccc2)c(c1)S(=O)(=O)C(F)(F)F
- IUPAC name:
N-[7-[4-[(2-bromophenyl)methyl]-4-methoxycyclohexyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide
- InChi:
InChI=1S/C40H48BrF3N6O5S3/c1-49(2)21-17-29(26-56-31-10-5-4-6-11-31)47-35-14-13-32(23-37(35)57(51,52)40(42,43)44)58(53,54)48-38-33-18-22-50(25-36(33)45-27-46-38)30-15-19-39(55-3,20-16-30)24-28-9-7-8-12-34(28)41/h4-14,23,27,29-30,47H,15-22,24-26H2,1-3H3,(H,45,46,48)/t29-,30-,39-/m1/s1
- InChiKey:
MCCLLJNTOCQCIM-DCWNVBBBSA-N
External links
![]() 51039626 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Karen Miller-Moslin, Bakary-Barry Toure, Michael Scott Visser, Naeem Yusuff, Novartis Ag. . Sulfonamides as inhibitors of bcl-2 family proteins for the treatment of cancer None. | 61 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
BCL2-Like / BAX | 6.51 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 924.20 g/mol | |||
HBA | 11 | |||
HBD | 2 | |||
HBA + HBD | 13 | |||
AlogP | 6.74 | |||
TPSA | 133.83 | |||
RB | 16 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2011029842 | 61 | BCL2 P10415 |
|
Biochemical assay | Surface Plasmon Resonance | pIC50 (half maximal inhibitory concentration, -log10) | 6.51 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.4800 | Navitoclax | DB12340 | |
0.3831 | GDC-0349 | DB13072 | |
0.3757 | Quinupristin | DB01369 | |
0.3738 | Metoserpate | DB11530 | |
0.3711 | Sulfaisodimidine | DB13283 | |
0.3696 | N-{2-[6-(2,4-DIAMINO-6-ETHYLPYRIMIDIN-5-YL)-2,2-DIMETHYL-3-OXO-2,3-DIHYDRO-4H-1,4-BENZOTHIAZIN-4-YL]ETHYL}ACETAMIDE | DB06899 | |
0.3655 | Yohimbine | DB01392 | |
0.3636 | Deserpidine | DB01089 | |
0.3634 | Vintafolide | DB05168 | |
0.3623 | Reserpine | DB00206 | |
0.3618 | Satavaptan | DB14923 | |
0.3615 | Vindesine | DB00309 | |
0.3601 | PF-232798 | DB14813 | |
0.3597 | Rivipansel | DB12778 | |
0.3595 | Vincamine | DB13374 |