Compound 1707
Identifiers
- Canonical SMILES:
CC(=N/N1CCN(Cc2ccccc2Cl)CC1)c1ccc(cc1)N(=O)=O
- IUPAC name:
(NE)-4-[(2-chlorophenyl)methyl]-N-[1-(4-nitrophenyl)ethylidene]piperazin-1-amine
- InChi:
InChI=1S/C19H21ClN4O2/c1-15(16-6-8-18(9-7-16)24(25)26)21-23-12-10-22(11-13-23)14-17-4-2-3-5-19(17)20/h2-9H,10-14H2,1H3
- InChiKey:
GKDCYDHTHCBRLI-UHFFFAOYSA-N
External links
![]() 1184893 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 51 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
LEDGF / IN | 4.72 | HIV infectious disease | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 372.14 g/mol | |||
HBA | 6 | |||
HBD | 0 | |||
HBA + HBD | 6 | |||
AlogP | 3.53 | |||
TPSA | 64.66 | |||
RB | 5 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.5372 | PAC-1 | DB13048 | |
0.5000 | Buclizine | DB00354 | |
0.4792 | Chlorcyclizine | DB08936 | |
0.4600 | Meclizine | DB00737 | |
0.4356 | Ambenonium | DB01122 | |
0.4324 | Hydroxyzine | DB00557 | |
0.4298 | Chlorbenzoxamine | DB13788 | |
0.4206 | Declopramide | DB06421 | |
0.4194 | Cyclizine | DB01176 | |
0.4078 | Clobenzorex | DB13561 | |
0.4068 | Levocetirizine | DB06282 | |
0.4068 | Cetirizine | DB00341 | |
0.3806 | Oxatomide | DB12877 | |
0.3772 | 7,8-Dichloro-1,2,3,4-tetrahydroisoquinoline | DB08550 | |
0.3772 | Moclobemide | DB01171 |