Compound 1706
Identifiers
- Canonical SMILES:
O=N(=O)c1ccccc1C=NN1CCN(Cc2ccccc2)CC1
- IUPAC name:
(NE)-4-benzyl-N-[(2-nitrophenyl)methylidene]piperazin-1-amine
- InChi:
InChI=1S/C18H20N4O2/c23-22(24)18-9-5-4-8-17(18)14-19-21-12-10-20(11-13-21)15-16-6-2-1-3-7-16/h1-9,14H,10-13,15H2
- InChiKey:
VKBQZSAOIDUDJG-UHFFFAOYSA-N
External links
![]() 1552523 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 50 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LEDGF / IN | 4.62 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 324.16 g/mol | |||
| HBA | 6 | |||
| HBD | 0 | |||
| HBA + HBD | 6 | |||
| AlogP | 3.08 | |||
| TPSA | 64.66 | |||
| RB | 5 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.5221 | PAC-1 | DB13048 | |
| 0.4204 | Procainamide | DB01035 | |
| 0.4118 | Plerixafor | DB06809 | |
| 0.4048 | Cyclizine | DB01176 | |
| 0.3830 | Buclizine | DB00354 | |
| 0.3818 | Antazoline | DB08799 | |
| 0.3814 | Histapyrrodine | DB13479 | |
| 0.3774 | Tripelennamine | DB00792 | |
| 0.3680 | Oxatomide | DB12877 | |
| 0.3670 | Thonzylamine | DB11235 | |
| 0.3663 | Declopramide | DB06421 | |
| 0.3636 | Imidocarb | DB11521 | |
| 0.3617 | Chlorcyclizine | DB08936 | |
| 0.3592 | Amithiozone | DB12829 | |
| 0.3558 | Amonafide | DB05022 |




