Compound 1705
Identifiers
- Canonical SMILES:
Cc1ccc(NN=C2/Sc3ccccc3C2=O)cc1
- IUPAC name:
(2Z)-2-[2-(4-methylphenyl)hydrazin-1-ylidene]-1-benzothiophen-3-one
- InChi:
InChI=1S/C15H12N2OS/c1-10-6-8-11(9-7-10)16-17-15-14(18)12-4-2-3-5-13(12)19-15/h2-9,16H,1H3
- InChiKey:
YFMADDFFVFAOSW-UHFFFAOYSA-N
External links
![]() 6802170 |
![]() CHEMBL2311903 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 48 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LEDGF / IN | 5.22 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 268.07 g/mol | |||
| HBA | 3 | |||
| HBD | 1 | |||
| HBA + HBD | 4 | |||
| AlogP | 4.66 | |||
| TPSA | 41.46 | |||
| RB | 2 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.3248 | Levosimendan | DB00922 | |
| 0.3245 | Tanomastat | DB06276 | |
| 0.3147 | Zaltoprofen | DB06737 | |
| 0.3077 | 2-[2-(4-Chloro-Phenylsulfanyl)-Acetylamino]-3-(4-Guanidino-Phenyl)-Propionamide | DB07105 | |
| 0.3064 | Eletriptan | DB00216 | |
| 0.3028 | Salirasib | DB12681 | |
| 0.3020 | 3-(5-Amino-3-imino-3H-pyrazol-4-ylazo)-benzoic acid | DB08668 | |
| 0.2903 | Simendan | DB12286 | |
| 0.2899 | Captodiame | DB09014 | |
| 0.2867 | Edaravone | DB12243 | |
| 0.2850 | Eltrombopag | DB06210 | |
| 0.2834 | Tazarotene | DB00799 | |
| 0.2831 | Naftazone | DB13680 | |
| 0.2820 | S,S'-(1,4-Phenylene-Bis(1,2-Ethanediyl))Bis-Isothiourea | DB02141 | |
| 0.2816 | 6-CHLORO-4-(CYCLOHEXYLSULFANYL)-3-PROPYLQUINOLIN-2(1H)-ONE | DB07868 |




