Compound 1704
Identifiers
- Canonical SMILES:
OC1=Cc2ccccc2C(=N/Nc2ccc(Cl)cc2)C1=O
- IUPAC name:
(1E)-1-[2-(4-chlorophenyl)hydrazin-1-ylidene]-3-hydroxynaphthalen-2-one
- InChi:
InChI=1S/C16H11ClN2O2/c17-11-5-7-12(8-6-11)18-19-15-13-4-2-1-3-10(13)9-14(20)16(15)21/h1-9,18,20H
- InChiKey:
MACZXHASJQIUCK-UHFFFAOYSA-N
External links
![]() 6154471 |
![]() CHEMBL2311902 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 47 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LEDGF / IN | 5.52 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 298.05 g/mol | |||
| HBA | 4 | |||
| HBD | 2 | |||
| HBA + HBD | 6 | |||
| AlogP | 4.41 | |||
| TPSA | 61.69 | |||
| RB | 2 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4142 | Naftazone | DB13680 | |
| 0.3927 | 2-[4-(4-Chlorophenyl)Cyclohexylidene]-3,4-Dihydroxy-1(2h)-Naphthalenone | DB04281 | |
| 0.3802 | Lapachone | DB11948 | |
| 0.3614 | Simendan | DB12286 | |
| 0.3558 | Cryptotanshinone | DB15579 | |
| 0.3553 | (1R, 2S)-cis 1,2 dihydroxy-1,2-dihydronaphthalene | DB08264 | |
| 0.3526 | Levosimendan | DB00922 | |
| 0.3518 | PF-03882845 | DB11814 | |
| 0.3450 | Polmacoxib | DB12399 | |
| 0.3378 | Pelubiprofen | DB12150 | |
| 0.3254 | Pitavastatin | DB08860 | |
| 0.3222 | GDC-0810 | DB12253 | |
| 0.3168 | BMS-181156 | DB02466 | |
| 0.3158 | 8-Hydroxy-4-(1-Hydroxyethyl)Quinoline-2-Carboxylic Acid | DB02566 | |
| 0.3148 | METHYL (2Z)-3-METHOXY-2-{2-[(E)-2-PHENYLVINYL]PHENYL}ACRYLATE | DB08330 |




