Compound 1702
Identifiers
- Canonical SMILES:
CN(C)c1ccc(cc1)N=Nc1ccc(Cl)cc1
- IUPAC name:
4-[(E)-2-(4-chlorophenyl)diazen-1-yl]-N,N-dimethylaniline
- InChi:
InChI=1S/C14H14ClN3/c1-18(2)14-9-7-13(8-10-14)17-16-12-5-3-11(15)4-6-12/h3-10H,1-2H3
- InChiKey:
WQWHNMIYCHFRJK-UHFFFAOYSA-N
External links
![]() 17226 |
![]() CHEMBL2311897 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 42 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LEDGF / IN | 5.70 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 259.09 g/mol | |||
| HBA | 3 | |||
| HBD | 0 | |||
| HBA + HBD | 3 | |||
| AlogP | 5.09 | |||
| TPSA | 27.96 | |||
| RB | 3 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4638 | Methyl red | DB08209 | |
| 0.4000 | m-Chlorophenylpiperazine | DB12110 | |
| 0.3968 | Triclocarban | DB11155 | |
| 0.3962 | Dinitrochlorobenzene | DB11831 | |
| 0.3750 | N-[(Aminooxy)Carbonyl]Aniline | DB04157 | |
| 0.3726 | 4-(Isopropylamino)diphenylamine | DB14195 | |
| 0.3699 | Phenazopyridine | DB01438 | |
| 0.3469 | 4-dimethylaminophenol | DB13549 | |
| 0.3448 | N-(Chlorophenyl)-N'-hydroxyguanidine | DB04559 | |
| 0.3425 | Proguanil | DB01131 | |
| 0.3269 | N-Allylaniline | DB02870 | |
| 0.3208 | N-phenylthiourea | DB03694 | |
| 0.3171 | p-Phenylenediamine | DB14141 | |
| 0.3165 | 1-(4-Amidinophenyl)-3-(4-Chlorophenyl)Urea | DB04336 | |
| 0.3165 | Chlorproguanil | DB12314 |




