Compound 1701
Identifiers
- Canonical SMILES:
N(N=C(N=Nc1ccccc1)/c1ccccc1)c1ccccc1
- IUPAC name:
(NE,E)-N'-(phenylamino)-N-(phenylimino)benzene-1-carboximidamide
- InChi:
InChI=1S/C19H16N4/c1-4-10-16(11-5-1)19(22-20-17-12-6-2-7-13-17)23-21-18-14-8-3-9-15-18/h1-15,20H
- InChiKey:
BEIHVSJTPTXQGB-UHFFFAOYSA-N
External links
![]() 68274 |
![]() CHEMBL2311896 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 41 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LEDGF / IN | 4.70 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 300.14 g/mol | |||
| HBA | 4 | |||
| HBD | 1 | |||
| HBA + HBD | 5 | |||
| AlogP | 5.64 | |||
| TPSA | 49.11 | |||
| RB | 4 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4421 | Diminazene | DB03608 | |
| 0.4000 | 3-(5-Amino-3-imino-3H-pyrazol-4-ylazo)-benzoic acid | DB08668 | |
| 0.3874 | 5-imino-4-(3-trifluoromethyl-phenylazo)-5H-pyrazol-3-ylamine | DB08666 | |
| 0.3805 | 5-Imino-4-(2-trifluoromethyl-phenylazo)-5H-pyrazol-3-ylamine | DB08671 | |
| 0.3710 | Sivifene | DB05686 | |
| 0.3585 | 4-(4-fluoro-phenylazo)-5-imino-5H-pyrazol-3-ylamine | DB08667 | |
| 0.3495 | Amithiozone | DB12829 | |
| 0.3468 | Simendan | DB12286 | |
| 0.3462 | Levosimendan | DB00922 | |
| 0.3433 | J147 | DB13957 | |
| 0.3429 | Benzodiazepine | DB12537 | |
| 0.3333 | Benzamidine | DB03127 | |
| 0.3300 | 8-(Pyrimidin-2-Ylamino)Naphthalene-2-Carboximidamide | DB04059 | |
| 0.3265 | 5-Amidino-Benzimidazole | DB01939 | |
| 0.3250 | 4-(Hydroxymethyl)Benzamidine | DB02585 |




