Compound 1700
Identifiers
- Canonical SMILES:
CCN(CC)c1ccc(C=C2/CCC(C=NN=Cc3cccnc3)=C2N2CCOCC2)cc1
- IUPAC name:
N,N-diethyl-4-{[(1E)-2-(morpholin-4-yl)-3-[(1E)-[(E)-2-(pyridin-3-ylmethylidene)hydrazin-1-ylidene]methyl]cyclopent-2-en-1-ylidene]methyl}aniline - InChi:
InChI=1S/C27H33N5O/c1-3-31(4-2)26-11-7-22(8-12-26)18-24-9-10-25(27(24)32-14-16-33-17-15-32)21-30-29-20-23-6-5-13-28-19-23/h5-8,11-13,18-21H,3-4,9-10,14-17H2,1-2H3
- InChiKey:
IFUPFELSZJZFLF-UHFFFAOYSA-N
External links
![]() 3528394 |
![]() CHEMBL2311893 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 38 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| LEDGF / IN | 5.52 | HIV infectious disease | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 443.27 g/mol | |||
| HBA | 6 | |||
| HBD | 0 | |||
| HBA + HBD | 6 | |||
| AlogP | 3.33 | |||
| TPSA | 53.32 | |||
| RB | 8 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.3504 | N-[4-CHLORO-3-(PYRIDIN-3-YLOXYMETHYL)-PHENYL]-3-FLUORO- | DB08068 | |
| 0.3433 | Daporinad | DB12731 | |
| 0.3394 | (4aS)-5-[(2,4-diaminopteridin-6-yl)methyl]-4a,5-dihydro-2H-dibenzo[b,f]azepin-8-ol | DB08448 | |
| 0.3304 | Terbogrel | DB12204 | |
| 0.3292 | GTS-21 | DB05708 | |
| 0.3273 | 3-(6-Aminopyridin-3-Yl)-N-Methyl-N-[(1-Methyl-1h-Indol-2-Yl)Methyl]Acrylamide | DB01865 | |
| 0.3267 | MGB-BP-3 | DB12892 | |
| 0.3250 | (2R,6S)-6-{[methyl(3,4,5-trimethoxyphenyl)amino]methyl}-1,2,5,6,7,8-hexahydroquinazoline-2,4-diamine | DB08642 | |
| 0.3246 | Rocacetrapib | DB15437 | |
| 0.3232 | Mesobiliverdin IV alpha | DB04363 | |
| 0.3218 | (2S)-1-(6H-INDOL-3-YL)-3-{[5-(7H-PYRAZOLO[3,4-C]PYRIDIN-5-YL)PYRIDIN-3-YL]OXY}PROPAN-2-AMINE | DB07124 | |
| 0.3160 | Lisuride | DB00589 | |
| 0.3148 | Tucidinostat | DB06334 | |
| 0.3132 | CP-724714 | DB12302 | |
| 0.3128 | Brilliant green cation | DB11279 |




