Compound 1690
Identifiers
- Canonical SMILES:
CCNc1nc(NCC)nc(n1)C(=O)NN
- IUPAC name:
bis(ethylamino)-1,3,5-triazine-2-carbohydrazide
- InChi:
InChI=1S/C8H15N7O/c1-3-10-7-12-5(6(16)15-9)13-8(14-7)11-4-2/h3-4,9H2,1-2H3,(H,15,16)(H2,10,11,12,13,14)
- InChiKey:
DJFDYAHDZXILCI-UHFFFAOYSA-N
External links
![]() 826430 |
![]() CHEMBL1597979 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Sanchez TW, Debnath B, Christ F, Otake H, Debyser Z, Neamati N. . Discovery of novel inhibitors of LEDGF/p75-IN protein-protein interactions. Bioorganic & medicinal chemistry. | 19 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
LEDGF / IN | 5.22 | HIV infectious disease | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 225.13 g/mol | |||
HBA | 8 | |||
HBD | 5 | |||
HBA + HBD | 13 | |||
AlogP | 0.18 | |||
TPSA | 117.85 | |||
RB | 5 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.4667 | Tretamine | DB14031 | |
0.4000 | Atrazine | DB07392 | |
0.3947 | Meladrazine | DB13272 | |
0.3816 | Terbutryn | DB08215 | |
0.3729 | Altretamine | DB00488 | |
0.3457 | (2S)-2-{[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino}-2-methylbutanenitrile | DB07551 | |
0.3457 | (2R)-2-{[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino}-2-methylbutanenitrile | DB07552 | |
0.3192 | Gedatolisib | DB11896 | |
0.3056 | Dacarbazine | DB00851 | |
0.2953 | PKI-179 | DB13109 | |
0.2889 | Bimiralisib | DB14846 | |
0.2824 | Enasidenib | DB13874 | |
0.2800 | Oteracil | DB03209 | |
0.2703 | Almitrine | DB01430 | |
0.2667 | 6-(3-BROMO-2-NAPHTHYL)-1,3,5-TRIAZINE-2,4-DIAMINE | DB07319 |