Compound 1561
Identifiers
- Canonical SMILES:
COc1cccc2c(CCNc3ccc(Nc4ccnc5[C@@H](O)CCc45)c(OC)c3F)c[nH]c12
- IUPAC name:
4-[3-fluoro-2-methoxy-4-[2-(7-methoxy-1H-indol-3-yl)ethylamino]anilino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol
- InChi:
InChI=1S/C26H27FN4O3/c1-33-22-5-3-4-16-15(14-30-25(16)22)10-12-28-19-7-8-20(26(34-2)23(19)27)31-18-11-13-29-24-17(18)6-9-21(24)32/h3-5,7-8,11,13-14,21,28,30,32H,6,9-10,12H2,1-2H3,(H,29,31)/t21-/m0/s1
- InChiKey:
HOVKIGHRDLSJBL-NRFANRHFSA-N
External links
![]() 168317945 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Virginie Sophie Poncelet, Sophie Coupa, Pierre-Henri Storck, Bruno Schoentjes, Janssen Pharmaceutica Nv. . Inhibitors of the interaction between mdm2 and p53 None. | 49 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 1 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 6.30 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 462.21 g/mol | |||
| HBA | 7 | |||
| HBD | 4 | |||
| HBA + HBD | 11 | |||
| AlogP | 3.62 | |||
| TPSA | 91.43 | |||
| RB | 8 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 1 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2009037308 | 49 | MDM2 Q00987 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 6.00 | |
| WO2009037308 | 49 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | A2780 cells | pIC50 (half maximal inhibitory concentration, -log10) | 6.30 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4817 | TACRINE(8)-4-AMINOQUINOLINE | DB04616 | |
| 0.4817 | (9S)-9-[(8-AMMONIOOCTYL)AMINO]-1,2,3,4,9,10-HEXAHYDROACRIDINIUM | DB04617 | |
| 0.4721 | 9-(3-IODOBENZYLAMINO)-1,2,3,4-TETRAHYDROACRIDINE | DB07940 | |
| 0.4684 | 9-N-Phenylmethylamino-Tacrine | DB03672 | |
| 0.4504 | Etrasimod | DB14766 | |
| 0.4500 | Frovatriptan | DB00998 | |
| 0.4457 | Serdemetan | DB12027 | |
| 0.4416 | Oxypertine | DB13403 | |
| 0.4398 | (1S)-1-(1H-INDOL-3-YLMETHYL)-2-(2-PYRIDIN-4-YL-[1,7]NAPHTYRIDIN-5-YLOXY)-EHYLAMINE | DB07204 | |
| 0.4310 | Cebranopadol | DB12830 | |
| 0.4247 | Ipidacrine | DB13668 | |
| 0.4229 | Nadifloxacin | DB12447 | |
| 0.4167 | Flutriciclamide F-18 | DB15380 | |
| 0.4146 | Emicerfont | DB12910 | |
| 0.4144 | Tacrine | DB00382 |




