Compound 15
Identifiers
- Canonical SMILES:
CN(C)CC[C@H](CSc1ccccc1)Nc1ccc(cc1S(=O)(=O)C(F)(F)F)S(=O)(=O)Nc1ncnc2CN(CCc12)C1CCN(Cc2ccccc2-c2cccc(Cl)c2)CC1
- InChi:
InChI=1S/C44H49ClF3N7O4S3/c1-53(2)21-17-34(29-60-36-12-4-3-5-13-36)51-40-16-15-37(26-42(40)61(56,57)44(46,47)48)62(58,59)52-43-39-20-24-55(28-41(39)49-30-50-43)35-18-22-54(23-19-35)27-32-9-6-7-14-38(32)31-10-8-11-33(45)25-31/h3-16,25-26,30,34-35,51H,17-24,27-29H2,1-2H3,(H,49,50,52)/t34-/m1/s1
- InChiKey:
SWCUWBBMUCSKHT-UUWRZZSWSA-N
External links
![]() 87251440 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Karen Miller-Moslin, Bakary-Barry Toure, Michael Scott Visser, Naeem Yusuff, Novartis Ag. . Sulfonamides as inhibitors of bcl-2 family proteins for the treatment of cancer None. | 97 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| BCL2-Like / BAX | 7.31 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 927.26 g/mol | |||
| HBA | 11 | |||
| HBD | 2 | |||
| HBA + HBD | 13 | |||
| AlogP | 6.70 | |||
| TPSA | 127.84 | |||
| RB | 16 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2011029842 | 97 | BCL2 P10415 |
|
Biochemical assay | Surface Plasmon Resonance | pIC50 (half maximal inhibitory concentration, -log10) | 7.31 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4920 | Navitoclax | DB12340 | |
| 0.3926 | Sulfaisodimidine | DB13283 | |
| 0.3924 | N-{2-[6-(2,4-DIAMINO-6-ETHYLPYRIMIDIN-5-YL)-2,2-DIMETHYL-3-OXO-2,3-DIHYDRO-4H-1,4-BENZOTHIAZIN-4-YL]ETHYL}ACETAMIDE | DB06899 | |
| 0.3919 | GDC-0349 | DB13072 | |
| 0.3719 | N-(2-(((5-CHLORO-2-PYRIDINYL)AMINO)SULFONYL)PHENYL)-4-(2-OXO-1(2H)-PYRIDINYL)BENZAMIDE | DB07800 | |
| 0.3713 | Presatovir | DB12165 | |
| 0.3588 | Quinupristin | DB01369 | |
| 0.3574 | Sparsentan | DB12548 | |
| 0.3552 | Sulfametomidine | DB13485 | |
| 0.3514 | 4-[(5-CHLOROINDOL-2-YL)SULFONYL]-2-(2-METHYLPROPYL)-1-[[5-(PYRIDIN-4-YL)PYRIMIDIN-2-YL]CARBONYL]PIPERAZINE | DB04673 | |
| 0.3511 | 5-(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine | DB07585 | |
| 0.3483 | Tianeptine | DB09289 | |
| 0.3475 | TAK-901 | DB12756 | |
| 0.3448 | 6-ethyl-5-[(2S)-1-(3-methoxypropyl)-2-phenyl-1,2,3,4-tetrahydroquinolin-7-yl]pyrimidine-2,4-diamine | DB08099 | |
| 0.3443 | Omidenepag isopropyl | DB15071 |




