Compound 147
Identifiers
- Canonical SMILES:
CC(C)(C)C[C@H]1N[C@H]([C@H](c2ccc(F)c(Cl)c2)[C@@]11C(=O)Nc2cc(Cl)c(F)cc12)C(=O)NC[C@H](O)[C@H](O)CO
- IUPAC name:
(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxo-N-[(2S,3R)-2,3,4-trihydroxybutyl]spiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide
- InChi:
InChI=1S/C27H31Cl2F2N3O5/c1-26(2,3)9-21-27(13-7-17(31)15(29)8-18(13)33-25(27)39)22(12-4-5-16(30)14(28)6-12)23(34-21)24(38)32-10-19(36)20(37)11-35/h4-8,19-23,34-37H,9-11H2,1-3H3,(H,32,38)(H,33,39)/t19-,20+,21+,22-,23+,27-/m0/s1
- InChiKey:
FIYLHPMFZUVLCU-HDUIEKHKSA-N
External links
![]() 24999802 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-19 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 3 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 6.30 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 585.16 g/mol | |||
HBA | 8 | |||
HBD | 6 | |||
HBA + HBD | 14 | |||
AlogP | 2.86 | |||
TPSA | 130.92 | |||
RB | 8 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 3 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2008036168 | 319-19 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 6.30 | |
WO2008036168 | 319-19 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.91 |
WO2008036168 | 319-19 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 5.57 |
WO2008036168 | 319-19 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.52 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.8216 | SAR-405838 | DB12541 | |
0.6996 | Milademetan | DB15257 | |
0.5540 | Degarelix | DB06699 | |
0.5510 | SLV-334 | DB15356 | |
0.5346 | Daglutril | DB05796 | |
0.5343 | Acyline | DB11906 | |
0.5288 | Abarelix | DB00106 | |
0.5155 | Brimapitide | DB15231 | |
0.5104 | Benazeprilat | DB14125 | |
0.5070 | Tifuvirtide | DB05413 | |
0.5056 | Polymyxin B | DB00781 | |
0.5051 | Mosapramine | DB13676 | |
0.5000 | Bivalirudin | DB00006 | |
0.5000 | Daptomycin | DB00080 | |
0.4952 | EC-0652 | DB15340 |