Compound 1453
Identifiers
- Canonical SMILES:
FC(F)(F)S(=O)(=O)c1cc(ccc1N[C@H](CCN1CCOCC1)CSc1ccccc1)S(=O)(=O)Nc1nnc2CN(CCn12)[C@@H]1CCCN(Cc2ccccc2-c2ccc(Cl)cc2)CC1
- InChi:
InChI=1S/C45H52ClF3N8O5S3/c46-35-14-12-33(13-15-35)40-11-5-4-7-34(40)30-55-20-6-8-37(19-22-55)56-23-24-57-43(31-56)51-52-44(57)53-65(60,61)39-16-17-41(42(29-39)64(58,59)45(47,48)49)50-36(18-21-54-25-27-62-28-26-54)32-63-38-9-2-1-3-10-38/h1-5,7,9-17,29,36-37,50H,6,8,18-28,30-32H2,(H,52,53)/t36-,37-/m1/s1
- InChiKey:
SXPGTYZKMYKKJU-FZNHDDJXSA-N
External links
![]() 168317975 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Karen Miller-Moslin, Bakary-Barry Toure, Michael Scott Visser, Naeem Yusuff, Novartis Ag. . Sulfonamides as inhibitors of bcl-2 family proteins for the treatment of cancer None. | 95 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| BCL2-Like / BAX | 5.72 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 972.29 g/mol | |||
| HBA | 13 | |||
| HBD | 2 | |||
| HBA + HBD | 15 | |||
| AlogP | 5.82 | |||
| TPSA | 142.00 | |||
| RB | 16 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2011029842 | 95 | BCL2 P10415 |
|
Biochemical assay | Surface Plasmon Resonance | pIC50 (half maximal inhibitory concentration, -log10) | 5.72 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.5429 | Navitoclax | DB12340 | |
| 0.3942 | Quinupristin | DB01369 | |
| 0.3746 | Presatovir | DB12165 | |
| 0.3684 | Danusertib | DB11778 | |
| 0.3684 | Lenacapavir | DB15673 | |
| 0.3683 | Elobixibat | DB12486 | |
| 0.3553 | Venetoclax | DB11581 | |
| 0.3454 | Neladenoson bialanate | DB13138 | |
| 0.3423 | Anatibant | DB05038 | |
| 0.3384 | Fenebrutinib | DB14785 | |
| 0.3374 | Virginiamycin S1 | DB04805 | |
| 0.3368 | Nelfinavir | DB00220 | |
| 0.3364 | Omidenepag isopropyl | DB15071 | |
| 0.3344 | Zanubrutinib | DB15035 | |
| 0.3342 | Nelivaptan | DB12643 |




