Compound 1413
Identifiers
- Canonical SMILES:
CC(C)(C)C[C@H]1N[C@H]([C@H](c2ccc(F)c(Cl)c2)[C@@]11C(=O)Nc2cc(Cl)c(F)cc12)C(=O)NCC[C@H](O)C(O)=O
- IUPAC name:
(2S)-4-[[(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-2-hydroxybutanoic acid
- InChi:
InChI=1S/C27H29Cl2F2N3O5/c1-26(2,3)11-20-27(13-9-17(31)15(29)10-18(13)33-25(27)39)21(12-4-5-16(30)14(28)8-12)22(34-20)23(36)32-7-6-19(35)24(37)38/h4-5,8-10,19-22,34-35H,6-7,11H2,1-3H3,(H,32,36)(H,33,39)(H,37,38)/t19-,20+,21-,22+,27-/m0/s1
- InChiKey:
DEPWIBRPLRYIHV-IHVVLDENSA-N
External links
![]() 25000115 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-16 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 3 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| MDM2-Like / P53 | 6.07 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 583.15 g/mol | |||
| HBA | 8 | |||
| HBD | 5 | |||
| HBA + HBD | 13 | |||
| AlogP | 1.40 | |||
| TPSA | 127.76 | |||
| RB | 8 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 3 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2008036168 | 319-16 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 6.07 | |
| WO2008036168 | 319-16 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.62 |
| WO2008036168 | 319-16 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 4.52 |
| WO2008036168 | 319-16 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.52 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.8444 | SAR-405838 | DB12541 | |
| 0.6771 | Milademetan | DB15257 | |
| 0.5263 | Mosapramine | DB13676 | |
| 0.5255 | SLV-334 | DB15356 | |
| 0.5247 | Degarelix | DB06699 | |
| 0.5099 | Daglutril | DB05796 | |
| 0.5066 | Idasanutlin | DB12325 | |
| 0.5024 | Acyline | DB11906 | |
| 0.4976 | Abarelix | DB00106 | |
| 0.4957 | MK-3207 | DB12424 | |
| 0.4948 | OPC-51803 | DB05838 | |
| 0.4913 | (3S)-N-(3-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07090 | |
| 0.4913 | (3S)-N-(5-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE | DB07222 | |
| 0.4897 | Brimapitide | DB15231 | |
| 0.4844 | Benazeprilat | DB14125 |




