Compound 1377
Identifiers
- Canonical SMILES:
CC(C)(C)C[C@H]1N[C@H]([C@H](c2ccc(F)c(Cl)c2)[C@@]11C(=O)Nc2cc(Cl)c(F)cc12)C(=O)NCC(O)=O
- IUPAC name:
2-[[(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]acetic acid
- InChi:
InChI=1S/C25H25Cl2F2N3O4/c1-24(2,3)9-18-25(12-7-16(29)14(27)8-17(12)31-23(25)36)20(11-4-5-15(28)13(26)6-11)21(32-18)22(35)30-10-19(33)34/h4-8,18,20-21,32H,9-10H2,1-3H3,(H,30,35)(H,31,36)(H,33,34)/t18-,20+,21-,25+/m1/s1
- InChiKey:
PSHPYIYVPCHSIR-XYHMEGALSA-N
External links
![]() 25000455 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Shaomeng Wang, Dongguang Qin, Jianyong Chen, Shanghai Yu, The Regents Of The University Of Michigan. . New small molecule inhibitors of mdm2 and the uses thereof None. | 319-15 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 3 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 6.46 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 539.12 g/mol | |||
HBA | 7 | |||
HBD | 4 | |||
HBA + HBD | 11 | |||
AlogP | 1.82 | |||
TPSA | 107.53 | |||
RB | 6 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 3 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2008036168 | 319-15 | MDM2 Q00987 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 6.46 | |
WO2008036168 | 319-15 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | LNCaP cells | pIC50 (half maximal inhibitory concentration, -log10) | 5.34 |
WO2008036168 | 319-15 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | HCT-116 cells p53WT | pIC50 (half maximal inhibitory concentration, -log10) | 4.92 |
WO2008036168 | 319-15 | MDM2 Q00987 |
|
Cellular assay | Proliferation assay | PC-3 cells | pIC50 (half maximal inhibitory concentration, -log10) | 4.52 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.8022 | SAR-405838 | DB12541 | |
0.6818 | Milademetan | DB15257 | |
0.5608 | SLV-334 | DB15356 | |
0.5436 | Daglutril | DB05796 | |
0.5413 | Degarelix | DB06699 | |
0.5355 | Benazeprilat | DB14125 | |
0.5213 | Mosapramine | DB13676 | |
0.5200 | Acyline | DB11906 | |
0.5177 | MK-3207 | DB12424 | |
0.5157 | Idasanutlin | DB12325 | |
0.5147 | Abarelix | DB00106 | |
0.5103 | Benazepril | DB00542 | |
0.5000 | Diamino-N-[(4S)-5-anilino-4-{[(2S)-2-{[(1R)-1-carboxyethyl]amino}-4-phenylbutanoyl]amino}-5-oxopentyl]methaniminium | DB02747 | |
0.4896 | OPC-51803 | DB05838 | |
0.4895 | Lumateperone | DB06077 |