Compound 1317
Identifiers
- Canonical SMILES:
CO[C@@]1(Cc2ccccc2-c2ccc(Cl)cc2)CC[C@@H](CC1)N1CCc2c(C1)ncnc2NS(=O)(=O)c1ccc(N[C@H](CCN(C)C)CSc2ccccc2)c(c1)S(=O)(=O)C(F)(F)F
- InChi:
InChI=1S/C46H52ClF3N6O5S3/c1-55(2)25-21-35(30-62-37-10-5-4-6-11-37)53-41-18-17-38(27-43(41)63(57,58)46(48,49)50)64(59,60)54-44-40-22-26-56(29-42(40)51-31-52-44)36-19-23-45(61-3,24-20-36)28-33-9-7-8-12-39(33)32-13-15-34(47)16-14-32/h4-18,27,31,35-36,53H,19-26,28-30H2,1-3H3,(H,51,52,54)/t35-,36-,45-/m1/s1
- InChiKey:
PPXWTTWYTKMGGB-NLXQXZJJSA-N
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Karen Miller-Moslin, Bakary-Barry Toure, Michael Scott Visser, Naeem Yusuff, Novartis Ag. . Sulfonamides as inhibitors of bcl-2 family proteins for the treatment of cancer None. | 60 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| BCL2-Like / BAX | 7.20 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 956.28 g/mol | |||
| HBA | 11 | |||
| HBD | 2 | |||
| HBA + HBD | 13 | |||
| AlogP | 8.22 | |||
| TPSA | 133.83 | |||
| RB | 17 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2011029842 | 60 | BCL2 P10415 |
|
Biochemical assay | Surface Plasmon Resonance | pIC50 (half maximal inhibitory concentration, -log10) | 7.20 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.5062 | Navitoclax | DB12340 | |
| 0.3834 | GDC-0349 | DB13072 | |
| 0.3800 | Quinupristin | DB01369 | |
| 0.3791 | N-{2-[6-(2,4-DIAMINO-6-ETHYLPYRIMIDIN-5-YL)-2,2-DIMETHYL-3-OXO-2,3-DIHYDRO-4H-1,4-BENZOTHIAZIN-4-YL]ETHYL}ACETAMIDE | DB06899 | |
| 0.3778 | Vintafolide | DB05168 | |
| 0.3654 | Metoserpate | DB11530 | |
| 0.3651 | PF-232798 | DB14813 | |
| 0.3647 | Presatovir | DB12165 | |
| 0.3642 | Tianeptine | DB09289 | |
| 0.3639 | Rivipansel | DB12778 | |
| 0.3626 | BMS-214662 | DB12234 | |
| 0.3612 | Sulfaisodimidine | DB13283 | |
| 0.3605 | Venetoclax | DB11581 | |
| 0.3584 | Bleomycin | DB00290 | |
| 0.3581 | 5-(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine | DB07585 |




