Compound 1291
Identifiers
- Canonical SMILES:
CN[C@@H](C)C(=O)N[C@H]1CC[C@H](C[C@H]2CC[C@H](N2C1=O)C(=O)N[C@H]1CCCc2ccccc12)NC(=O)Cc1ccccc1
- IUPAC name:
(3S,6S,9R,10aR)-6-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-9-[(2-phenylacetyl)amino]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide
- InChi:
InChI=1S/C33H43N5O4/c1-21(34-2)31(40)37-28-17-15-24(35-30(39)19-22-9-4-3-5-10-22)20-25-16-18-29(38(25)33(28)42)32(41)36-27-14-8-12-23-11-6-7-13-26(23)27/h3-7,9-11,13,21,24-25,27-29,34H,8,12,14-20H2,1-2H3,(H,35,39)(H,36,41)(H,37,40)/t21-,24+,25+,27-,28-,29-/m0/s1
- InChiKey:
BOOCCBUATVVXCL-CUQYSNLNSA-N
External links
![]() 168318006 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sun H, Lu J, Liu L, Yi H, Qiu S, Yang CY, Deschamps JR, Wang S. . Nonpeptidic and potent small-molecule inhibitors of cIAP-1/2 and XIAP proteins. Journal of medicinal chemistry. | 7 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| XIAP / Smac | 7.52 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 573.33 g/mol | |||
| HBA | 9 | |||
| HBD | 4 | |||
| HBA + HBD | 13 | |||
| AlogP | 2.27 | |||
| TPSA | 119.64 | |||
| RB | 8 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 20684551 | 7 | XIAP P98170 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 6.90 | |
| 20684551 | 7 | XIAP P98170 |
|
Biochemical assay | Fluorescence Polarization | pKi (inhibition constant, -log10) | 7.52 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.8364 | 1-[3,3-Dimethyl-2-(2-Methylamino-Propionylamino)-Butyryl]-Pyrrolidine-2-Carboxylic Acid(1,2,3,4-Tetrahydro-Naphthalen-1-Yl)-Amide | DB02628 | |
| 0.7500 | (R)-Praziquantel | DB11749 | |
| 0.7500 | Praziquantel | DB01058 | |
| 0.6870 | D-phenylalanyl-N-benzyl-L-prolinamide | DB07143 | |
| 0.6846 | (S)-2-[(R)-3-amino-4-(2-fluorophenyl)butyryl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide | DB04578 | |
| 0.6639 | D-phenylalanyl-N-(3-methylbenzyl)-L-prolinamide | DB07133 | |
| 0.6587 | Semagacestat | DB12463 | |
| 0.6557 | D-phenylalanyl-N-(3-fluorobenzyl)-L-prolinamide | DB07027 | |
| 0.6491 | Dexetimide | DB08997 | |
| 0.6371 | D-phenylalanyl-N-(3-chlorobenzyl)-L-prolinamide | DB06919 | |
| 0.6371 | D-phenylalanyl-N-{4-[amino(iminio)methyl]benzyl}-L-prolinamide | DB07005 | |
| 0.6269 | Palonosetron | DB00377 | |
| 0.6210 | N-({(2S)-1-[(3R)-3-AMINO-4-(2-FLUOROPHENYL)BUTANOYL]PYRROLIDIN-2-YL}METHYL)BENZAMIDE | DB07779 | |
| 0.6131 | Quinaprilat | DB14217 | |
| 0.6121 | N-Methylphenylalanyl-N-[(trans-4-aminocyclohexyl)methyl]-L-prolinamide | DB08187 |




