Compound 1268
Identifiers
- Canonical SMILES:
CN(C)CC[C@H](CSc1ccccc1)Nc1ccc(cc1N(=O)=O)S(=O)(=O)Nc1nc(nc2CN(CCc12)C1CCN(Cc2ccccc2-c2ccc(Cl)cc2)CC1)C(F)(F)F
- IUPAC name:
N-[7-[1-[[2-(4-chlorophenyl)phenyl]methyl]piperidin-4-yl]-2-(trifluoromethyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide
- InChi:
InChI=1S/C44H48ClF3N8O4S2/c1-53(2)22-18-33(29-61-35-9-4-3-5-10-35)49-39-17-16-36(26-41(39)56(57)58)62(59,60)52-42-38-21-25-55(28-40(38)50-43(51-42)44(46,47)48)34-19-23-54(24-20-34)27-31-8-6-7-11-37(31)30-12-14-32(45)15-13-30/h3-17,26,33-34,49H,18-25,27-29H2,1-2H3,(H,50,51,52)/t33-/m1/s1
- InChiKey:
CAVGCVJHYTXBRI-MGBGTMOVSA-N
External links
![]() 51039624 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Karen Miller-Moslin, Bakary-Barry Toure, Michael Scott Visser, Naeem Yusuff, Novartis Ag. . Sulfonamides as inhibitors of bcl-2 family proteins for the treatment of cancer None. | 71 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 1 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| BCL2-Like / BAX | 7.70 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 908.29 g/mol | |||
| HBA | 12 | |||
| HBD | 2 | |||
| HBA + HBD | 14 | |||
| AlogP | 7.62 | |||
| TPSA | 139.52 | |||
| RB | 16 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 1 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| WO2011029842 | 71 | BCL2 P10415 |
|
Biochemical assay | Surface Plasmon Resonance | pIC50 (half maximal inhibitory concentration, -log10) | 7.70 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.4305 | GDC-0349 | DB13072 | |
| 0.4106 | Sulfaisodimidine | DB13283 | |
| 0.3988 | Navitoclax | DB12340 | |
| 0.3887 | Presatovir | DB12165 | |
| 0.3759 | Gemigliptin | DB12412 | |
| 0.3725 | Tasosartan | DB01349 | |
| 0.3674 | Bleomycin | DB00290 | |
| 0.3667 | PF-03814735 | DB13059 | |
| 0.3654 | N-{2-[6-(2,4-DIAMINO-6-ETHYLPYRIMIDIN-5-YL)-2,2-DIMETHYL-3-OXO-2,3-DIHYDRO-4H-1,4-BENZOTHIAZIN-4-YL]ETHYL}ACETAMIDE | DB06899 | |
| 0.3636 | Lenacapavir | DB15673 | |
| 0.3626 | Sparsentan | DB12548 | |
| 0.3624 | CH-5132799 | DB13051 | |
| 0.3602 | Venetoclax | DB11581 | |
| 0.3576 | BMS-919373 | DB15047 | |
| 0.3563 | Quinupristin | DB01369 |




