Compound 1251
Identifiers
- Canonical SMILES:
C[C@H](N)c1nc(co1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O
- IUPAC name:
(2S)-2-[[(2S)-1-[2-[(1S)-1-aminoethyl]-1,3-oxazole-4-carbonyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid
- InChi:
InChI=1S/C22H25N5O5/c1-12(23)20-26-17(11-32-20)21(29)27-8-4-7-18(27)19(28)25-16(22(30)31)9-13-10-24-15-6-3-2-5-14(13)15/h2-3,5-6,10-12,16,18,24H,4,7-9,23H2,1H3,(H,25,28)(H,30,31)/t12-,16-,18-/m0/s1
- InChiKey:
FBRCDLGEWAXPMI-IWEFOYFVSA-N
External links
![]() 15991584 |
![]() CHEMBL393164 |
![]() 13122517 |
CO9 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Wist AD, Gu L, Riedl SJ, Shi Y, McLendon GL. . Structure-activity based study of the Smac-binding pocket within the BIR3 domain of XIAP. Bioorganic & medicinal chemistry. | 2 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
XIAP / Smac | 4.52 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 439.19 g/mol | |||
HBA | 10 | |||
HBD | 5 | |||
HBA + HBD | 15 | |||
AlogP | -1.58 | |||
TPSA | 154.55 | |||
RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.5899 | LTX-109 | DB12711 | |
0.5736 | Oglufanide | DB05779 | |
0.5714 | Nerofe | DB14786 | |
0.5696 | Retosiban | DB11818 | |
0.5677 | Gonadorelin | DB00644 | |
0.5663 | Gramicidin D | DB00027 | |
0.5658 | Murepavadin | DB14777 | |
0.5656 | Edratide | DB15272 | |
0.5637 | Somatoprim | DB12777 | |
0.5628 | Triptorelin | DB06825 | |
0.5628 | Deslorelin | DB11510 | |
0.5628 | Leuprolide | DB00007 | |
0.5628 | Nafarelin | DB00666 | |
0.5565 | Afamelanotide | DB04931 | |
0.5519 | Cotadutide | DB15194 |