Compound 1134
Identifiers
- Canonical SMILES:
Cc1[nH]c2ccccc2c1CCNc1c(Cl)cc(Nc2ccnc(CO)c2)cc1Cl
- IUPAC name:
[4-[3,5-dichloro-4-[2-(2-methyl-1H-indol-3-yl)ethylamino]anilino]pyridin-2-yl]methanol
- InChi:
InChI=1S/C23H22Cl2N4O/c1-14-18(19-4-2-3-5-22(19)28-14)7-9-27-23-20(24)11-16(12-21(23)25)29-15-6-8-26-17(10-15)13-30/h2-6,8,10-12,27-28,30H,7,9,13H2,1H3,(H,26,29)
- InChiKey:
IRTGHXHKBBVTPC-UHFFFAOYSA-N
External links
![]() 59493255 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Virginie Sophie Poncelet, Sophie Coupa, Pierre-Henri Storck, Bruno Schoentjes, Janssen Pharmaceutica Nv. . Inhibitors of the interaction between mdm2 and p53 None. | 25 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
1 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
MDM2-Like / P53 | 5.52 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 440.12 g/mol | |||
HBA | 5 | |||
HBD | 4 | |||
HBA + HBD | 9 | |||
AlogP | 4.50 | |||
TPSA | 72.97 | |||
RB | 7 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 1 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
WO2009037308 | 25 | MDM2 Q00987 |
|
Biochemical assay | ELISA | pIC50 (half maximal inhibitory concentration, -log10) | 5.52 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.6555 | Serdemetan | DB12027 | |
0.5000 | Oxypertine | DB13403 | |
0.4937 | Indibulin | DB06169 | |
0.4874 | Dimethyltryptamine | DB01488 | |
0.4754 | Diethyltryptamine | DB01460 | |
0.4752 | Rizatriptan | DB00953 | |
0.4724 | Bufotenine | DB01445 | |
0.4717 | Frovatriptan | DB00998 | |
0.4645 | TACRINE(8)-4-AMINOQUINOLINE | DB04616 | |
0.4645 | (9S)-9-[(8-AMMONIOOCTYL)AMINO]-1,2,3,4,9,10-HEXAHYDROACRIDINIUM | DB04617 | |
0.4601 | Mdl-29951 | DB04175 | |
0.4586 | Dipropyl-4-hydroxytryptamine | DB13990 | |
0.4583 | Sumatriptan | DB00669 | |
0.4518 | N-acetylserotonin | DB04275 | |
0.4511 | 5-methoxy-N,N-dimethyltryptamine | DB14010 |