Compound 1093
Identifiers
- Canonical SMILES:
CN[C@@H](C)C(=O)N[C@H]1CN(CC[C@H]2CC[C@H](N2C1=O)C(=O)NC(c1ccccc1)c1ccccc1)C(=O)Cc1ccccc1
- IUPAC name:
(5S,8S,10aR)-N-benzhydryl-5-[[(2S)-2-(methylamino)propanoyl]amino]-6-oxo-3-(2-phenylacetyl)-1,2,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,5]diazocine-8-carboxamide
- InChi:
InChI=1S/C35H41N5O4/c1-24(36-2)33(42)37-29-23-39(31(41)22-25-12-6-3-7-13-25)21-20-28-18-19-30(40(28)35(29)44)34(43)38-32(26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17,24,28-30,32,36H,18-23H2,1-2H3,(H,37,42)(H,38,43)/t24-,28+,29-,30-/m0/s1
- InChiKey:
YBYZHVZWINISJO-XPSCAIQQSA-N
External links
![]() 25172871 |
![]() CHEMBL504559 |
![]() 24710510 |
External search
![]() |
![]() |
![]() |
![]() |
![]() |
Bibliography (1)
Publication | Name |
---|---|
Sun H, Lu J, Liu L, Yi H, Qiu S, Yang CY, Deschamps JR, Wang S. . Nonpeptidic and potent small-molecule inhibitors of cIAP-1/2 and XIAP proteins. Journal of medicinal chemistry. | 2 |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
2 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|---|---|---|
XIAP / Smac | 6.96 | cancer | Inhibition |
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | 595.32 g/mol | |||
HBA | 9 | |||
HBD | 3 | |||
HBA + HBD | 12 | |||
AlogP | 2.65 | |||
TPSA | 110.85 | |||
RB | 9 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 2 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|---|---|---|---|---|---|---|---|
20684551 | 2 | XIAP P98170 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 6.44 | |
20684551 | 2 | XIAP P98170 |
|
Biochemical assay | Fluorescence Polarization | pKi (inhibition constant, -log10) | 6.96 |
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.7170 | D-phenylalanyl-N-benzyl-L-prolinamide | DB07143 | |
0.6909 | D-phenylalanyl-N-(3-methylbenzyl)-L-prolinamide | DB07133 | |
0.6759 | 3-cyclohexyl-D-alanyl-N-(3-chlorobenzyl)-L-prolinamide | DB07190 | |
0.6754 | (R)-Praziquantel | DB11749 | |
0.6754 | Praziquantel | DB01058 | |
0.6667 | D-phenylalanyl-N-(3-fluorobenzyl)-L-prolinamide | DB07027 | |
0.6636 | N-cyclooctylglycyl-N-(4-carbamimidoylbenzyl)-L-prolinamide | DB06858 | |
0.6609 | D-phenylalanyl-N-(3-chlorobenzyl)-L-prolinamide | DB06919 | |
0.6609 | D-phenylalanyl-N-{4-[amino(iminio)methyl]benzyl}-L-prolinamide | DB07005 | |
0.6574 | N-cycloheptylglycyl-N-(4-carbamimidoylbenzyl)-L-prolinamide | DB06853 | |
0.6574 | (S)-N-(4-carbamimidoylbenzyl)-1-(3-cyclopentylpropanoyl)pyrrolidine-2-carboxamide | DB07095 | |
0.6574 | (S)-N-(4-carbamimidoylbenzyl)-1-(3-cyclohexylpropanoyl)pyrrolidine-2-carboxamide | DB07131 | |
0.6482 | (S)-N-(4-carbamimidoylbenzyl)-1-(2-(cyclohexylamino)ethanoyl)pyrrolidine-2-carboxamide | DB06850 | |
0.6449 | 1-[(2R)-2-aminobutanoyl]-N-(3-chlorobenzyl)-L-prolinamide | DB06878 | |
0.6449 | D-leucyl-N-(3-chlorobenzyl)-L-prolinamide | DB06911 |