Compound 1063
Identifiers
- Canonical SMILES:
CN[C@@H](C)C(=O)N[C@H]1CC[C@@H](C[C@H]2CC[C@H](N2C1=O)C(=O)NC(c1ccccc1)c1ccccc1)NC(=O)Cc1ccccc1
- IUPAC name:
(3S,6S,9R,10aR)-N-benzhydryl-6-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-9-[(2-phenylacetyl)amino]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide
- InChi:
InChI=1S/C36H43N5O4/c1-24(37-2)34(43)39-30-20-18-28(38-32(42)22-25-12-6-3-7-13-25)23-29-19-21-31(41(29)36(30)45)35(44)40-33(26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17,24,28-31,33,37H,18-23H2,1-2H3,(H,38,42)(H,39,43)(H,40,44)/t24-,28-,29+,30-,31-/m0/s1
- InChiKey:
KQTBMWSEIIBSGS-SLHNNEBYSA-N
External links
![]() 46929438 |
![]() CHEMBL1241425 |
![]() 26352044 |
External search
|
|
|
|
|
Bibliography (1)
| Publication | Name |
|---|---|
| Sun H, Lu J, Liu L, Yi H, Qiu S, Yang CY, Deschamps JR, Wang S. . Nonpeptidic and potent small-molecule inhibitors of cIAP-1/2 and XIAP proteins. Journal of medicinal chemistry. | 6 |
Pharmacological data
| Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|
| 2 | 0 | 0 | 0 |
Targets
| PPI family | Best activity | Diseases | MMoA |
|---|---|---|---|
| XIAP / Smac | 6.52 | cancer | Inhibition |
Physicochemical filters
| Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
|---|---|---|---|---|
| Compliance | ||||
| MW | 609.33 g/mol | |||
| HBA | 9 | |||
| HBD | 4 | |||
| HBA + HBD | 13 | |||
| AlogP | 3.06 | |||
| TPSA | 119.64 | |||
| RB | 10 |
Radar chart
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
| Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
|---|---|---|---|---|
| 1 | 2 | 0 | 0 | 0 |
Pharmacological data
| Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
|---|---|---|---|---|---|---|---|---|
| 20684551 | 6 | XIAP P98170 |
|
Biochemical assay | Fluorescence Polarization | pIC50 (half maximal inhibitory concentration, -log10) | 6.00 | |
| 20684551 | 6 | XIAP P98170 |
|
Biochemical assay | Fluorescence Polarization | pKi (inhibition constant, -log10) | 6.52 |
| Ta | Structure | Name | Drugbank ID |
|---|---|---|---|
| 0.7308 | D-phenylalanyl-N-benzyl-L-prolinamide | DB07143 | |
| 0.7037 | D-phenylalanyl-N-(3-methylbenzyl)-L-prolinamide | DB07133 | |
| 0.6887 | 3-cyclohexyl-D-alanyl-N-(3-chlorobenzyl)-L-prolinamide | DB07190 | |
| 0.6875 | (R)-Praziquantel | DB11749 | |
| 0.6875 | Praziquantel | DB01058 | |
| 0.6786 | D-phenylalanyl-N-(3-fluorobenzyl)-L-prolinamide | DB07027 | |
| 0.6762 | N-cyclooctylglycyl-N-(4-carbamimidoylbenzyl)-L-prolinamide | DB06858 | |
| 0.6726 | D-phenylalanyl-N-(3-chlorobenzyl)-L-prolinamide | DB06919 | |
| 0.6726 | D-phenylalanyl-N-{4-[amino(iminio)methyl]benzyl}-L-prolinamide | DB07005 | |
| 0.6698 | N-cycloheptylglycyl-N-(4-carbamimidoylbenzyl)-L-prolinamide | DB06853 | |
| 0.6698 | (S)-N-(4-carbamimidoylbenzyl)-1-(3-cyclopentylpropanoyl)pyrrolidine-2-carboxamide | DB07095 | |
| 0.6698 | (S)-N-(4-carbamimidoylbenzyl)-1-(3-cyclohexylpropanoyl)pyrrolidine-2-carboxamide | DB07131 | |
| 0.6604 | (S)-N-(4-carbamimidoylbenzyl)-1-(2-(cyclohexylamino)ethanoyl)pyrrolidine-2-carboxamide | DB06850 | |
| 0.6571 | 1-[(2R)-2-aminobutanoyl]-N-(3-chlorobenzyl)-L-prolinamide | DB06878 | |
| 0.6571 | D-leucyl-N-(3-chlorobenzyl)-L-prolinamide | DB06911 |




